|
|
| | t-Butyl-4-(2-amino-1-phenylethyl)piperazine carboxylate Basic information |
| | t-Butyl-4-(2-amino-1-phenylethyl)piperazine carboxylate Chemical Properties |
| Boiling point | 410.3±45.0 °C(Predicted) | | density | 1.110±0.06 g/cm3 (20 ºC 760 Torr) | | pka | 9.37±0.10(Predicted) | | form | solid | | InChI | 1S/C17H27N3O2/c1-17(2,3)22-16(21)20-11-9-19(10-12-20)15(13-18)14-7-5-4-6-8-14/h4-8,15H,9-13,18H2,1-3H3 | | InChIKey | NOVUBWBKZLPMFG-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(CN)c2ccccc2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | HS Code | 2933599590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | t-Butyl-4-(2-amino-1-phenylethyl)piperazine carboxylate Usage And Synthesis |
| | t-Butyl-4-(2-amino-1-phenylethyl)piperazine carboxylate Preparation Products And Raw materials |
|