(2-Chloropyrimidin-4-yl)methanol manufacturers
|
| | (2-Chloropyrimidin-4-yl)methanol Basic information |
| Product Name: | (2-Chloropyrimidin-4-yl)methanol | | Synonyms: | 4-Pyrimidinemethanol, 2-chloro- (9CI);4-Pyrimidinemethanol, 2-chloro-;(2-chloro-4-pyrimidinyl)methanol;2-Chloropyrimidine-4-methanol;(2-chloropyrimidin-4-yl)methanol - [C86548];(2-chloropyrimidin-4-yl)methanol | | CAS: | 34953-87-2 | | MF: | C5H5ClN2O | | MW: | 144.56 | | EINECS: | 233-305-4 | | Product Categories: | PYRIMIDINE | | Mol File: | 34953-87-2.mol |  |
| | (2-Chloropyrimidin-4-yl)methanol Chemical Properties |
| Boiling point | 341.8±17.0 °C(Predicted) | | density | 1.422±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 13.05±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C5H5ClN2O/c6-5-7-2-1-4(3-9)8-5/h1-2,9H,3H2 | | InChIKey | POXLTMBMLWQOQG-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(CO)=N1 |
| | (2-Chloropyrimidin-4-yl)methanol Usage And Synthesis |
| Chemical Properties | yellow solid | | Uses | (2-Chloropyrimidin-4-yl)methanol is a heterocyclic compound containing reactive chlorine and hydroxyl functional groups. It can be used as a pharmaceutical intermediate in the preparation of active substances such as MCL-1 inhibitors. | | Synthesis | The method for the synthesis of (2-chloropyrimidin-4-yl)methanol is as follows: To a solution of 2-chloropyrimidine-4-carboxylic (isobutyl carbonic) anhydride (16.3 g, 63.0 mmol) in Tetrahydrofuran (200 mL) and water (20 mL) was added sodium borohydride (4.7 g, 124.8 mmol) at 0 °C dropwise. Then the mixture was stirred at 0 °C for 1 hour. The reaction mixture was quenched with aqueous NH4Cl (20 mL) and diluted with water (100 mL), extracted with ethyl acetate (100 mL x 2), washed with brine (50 mL x 2), dried over Na2SO4, filtered and concentrated to residue which was purified by silica gel chromatography (solvent gradient: 0- 50% ethyl acetate in petroleum ether) to afford (2-chloropyrimidin-4-yl)methanol (3 g, 33% yield) as a yellow solid.
 |
| | (2-Chloropyrimidin-4-yl)methanol Preparation Products And Raw materials |
|