| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2lambda5,4lambda5-catenadi(phosphazene) manufacturers
|
| | 1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2lambda5,4lambda5-catenadi(phosphazene) Basic information |
| Product Name: | 1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2lambda5,4lambda5-catenadi(phosphazene) | | Synonyms: | TETRAMETHYL(TRIS(DIMETHYLAMINO)PHOSPHOR&;N,N,N',N'-TETRAMETHYL-N''-[TRIS(DIMETHYLAMINO)PHOSPHORANYLIDENE]PHOSPHORIC TRIAMIDE ETHYLIMINE;PHOSPHAZENE BASE P2-ET;1-ethyl-2,2,4,4,4-pentakis(dimethylamino)-2λ5,4λ5-catenadi(phosphazene);1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2λ5,4λ5-catenadi(phosphazene), Tetramethyl(tris(dimethylamino)phosphoranylidene)phosphorictriamid-Et-imin;Phosphazene base P2-Et purum, >=98.0% (NT);Phosphazene base P2-Et >=98.0% (NT);Phosphazene base P | | CAS: | 165535-45-5 | | MF: | C12H35N7P2 | | MW: | 339.4 | | EINECS: | | | Product Categories: | | | Mol File: | 165535-45-5.mol |  |
| | 1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2lambda5,4lambda5-catenadi(phosphazene) Chemical Properties |
| Boiling point | 96 °C0.05 mm Hg(lit.) | | density | 1.02 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.492(lit.) | | Fp | 113 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 7485991 | | InChI | 1S/C12H35N7P2/c1-12-13-20(15(2)3,16(4)5)14-21(17(6)7,18(8)9)19(10)11/h12H2,1-11H3 | | InChIKey | CFUKEHPEQCSIOM-UHFFFAOYSA-N | | SMILES | CCN=P(N=P(N(C)C)(N(C)C)N(C)C)(N(C)C)N(C)C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 3 | | F | 3-10-21-34 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2lambda5,4lambda5-catenadi(phosphazene) Usage And Synthesis |
| Uses | P2Et phosphazene is a strong non-ionic base has the ability to catalyze a wide variety of organic transformations. This includes but is not limited to cross coupling reactions, deprotonation of sulphones and conversion of vinyl sufone to allyl sulfone |
| | 1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2lambda5,4lambda5-catenadi(phosphazene) Preparation Products And Raw materials |
|