| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 2,4-Diaminobenzoic acid Basic information |
| Product Name: | 2,4-Diaminobenzoic acid | | Synonyms: | 2,4-DIAMINOBENZOIC ACID DIHYDROCHLORIDE;2,4-bis(azanyl)benzoic acid;Benzoic acid, 2,4-diamino-;2,4-DIAMINOBENZOIC ACID | | CAS: | 611-03-0 | | MF: | C7H8N2O2 | | MW: | 152.15 | | EINECS: | | | Product Categories: | | | Mol File: | 611-03-0.mol |  |
| | 2,4-Diaminobenzoic acid Chemical Properties |
| Melting point | 140°C | | Boiling point | 274.61°C (rough estimate) | | density | 1.2804 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 5.60±0.10(Predicted) | | Appearance | Brown to black Solid | | InChI | 1S/C7H8N2O2.2ClH/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3H,8-9H2,(H,10,11);2*1H | | InChIKey | LAVHFNVUGYKNGS-UHFFFAOYSA-N | | SMILES | Cl.Cl.Nc1ccc(c(N)c1)C(O)=O | | CAS DataBase Reference | 611-03-0 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2,4-Diaminobenzoic acid Usage And Synthesis |
| Uses | 2,4-Diaminobenzoic Acid is a reagent used in the optimization of quinazolinones acting as anti-tubercular agents. Also used in the preparation of DNA Polymerase III inhibitors. |
| | 2,4-Diaminobenzoic acid Preparation Products And Raw materials |
|