|
|
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-ethynyl-, 1,1-dimethylethyl ester Basic information |
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-ethynyl-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 291.6±40.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | -1.32±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H19NO2/c1-5-10-6-13(7-10)8-14(9-13)11(15)16-12(2,3)4/h1,10H,6-9H2,2-4H3 | | InChIKey | JLCQNQNUSIBUBJ-UHFFFAOYSA-N | | SMILES | C1C2(CC(C#C)C2)CN1C(OC(C)(C)C)=O |
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-ethynyl-, 1,1-dimethylethyl ester Usage And Synthesis |
| | 2-Azaspiro[3.3]heptane-2-carboxylic acid, 6-ethynyl-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|