| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Indazol-1-yl-acetic acid manufacturers
|
| | Indazol-1-yl-acetic acid Basic information |
| | Indazol-1-yl-acetic acid Chemical Properties |
| Melting point | 117-121℃ | | Boiling point | 356.1±31.0 °C(Predicted) | | density | 1.276±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 4.18±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H10O3/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8/h1-4,8H,5-6H2,(H,11,12) | | InChIKey | UGAGZMGJJFSKQM-UHFFFAOYSA-N | | SMILES | C1OC2=CC=CC=C2CC1C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-52-51-36 | | Safety Statements | 26-36/37/39-45 | | WGK Germany | 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Indazol-1-yl-acetic acid Usage And Synthesis |
| | Indazol-1-yl-acetic acid Preparation Products And Raw materials |
|