| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
.alpha.-D-Glucopyranoside, phenyl 1-thio-, tetraacetate manufacturers
|
| | .alpha.-D-Glucopyranoside, phenyl 1-thio-, tetraacetate Basic information |
| Product Name: | .alpha.-D-Glucopyranoside, phenyl 1-thio-, tetraacetate | | Synonyms: | .alpha.-D-Glucopyranoside, phenyl 1-thio-, tetraacetate;phenyl 2,3,4,6-tetra-O-acetyl-α-D-1-thio-Mannoside;Phenyl 2,3,4,6-tetra-O-acetyl-α-D-thiomannopyranoside;Phenyl 1-thio-alpha-D-glucopyranoside 2,3,4,6-tetraacetate;Phenyl 2,3,4,6-tetra-O-acetyl-alpha-D-thiomannopyranoside 97%;(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-(phenylthio)tetrahydro-2H-pyran-3,4,5-triyl triacetate;(3,4,5-Triacetyloxy-6-phenylsulfanyloxan-2-yl)methyl acetate;(2R,3R,4S,5R,6R)-3,4,5-tris(acetyloxy)-6-(phenylsulfanyl)oxan-2-yl]methyl acetate | | CAS: | 13992-16-0 | | MF: | C20H24O9S | | MW: | 440.47 | | EINECS: | | | Product Categories: | | | Mol File: | 13992-16-0.mol |  |
| | .alpha.-D-Glucopyranoside, phenyl 1-thio-, tetraacetate Chemical Properties |
| Melting point | 85-87°C | | Boiling point | 514.6±50.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | InChI | InChI=1/C20H24O9S/c1-11(21)25-17-16(10-15-8-6-5-7-9-15)28-20(30-29-14(4)24)19(27-13(3)23)18(17)26-12(2)22/h5-9,16-20H,10H2,1-4H3/t16-,17-,18+,19-,20-/s3 | | InChIKey | XGVRJQXCDRSLIC-SKAYCTISNA-N | | SMILES | S(OC(=O)C)[C@H]1O[C@H](CC2=CC=CC=C2)[C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H]1OC(=O)C |&1:5,7,15,20,25,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | .alpha.-D-Glucopyranoside, phenyl 1-thio-, tetraacetate Usage And Synthesis |
| Uses | Phenyl 2,3,4,6-tetra-O-acetyl-α-D-thiomannopyranoside is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | .alpha.-D-Glucopyranoside, phenyl 1-thio-, tetraacetate Preparation Products And Raw materials |
|