- Tebanicline
-
- $2.00
-
2026-08-25
- CAS:198283-73-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | ABT-594 Basic information |
| Product Name: | ABT-594 | | Synonyms: | ABT-594;ABT 594,Tebanicline;(R)-5-(azetidin-2-ylmethoxy)-2-chloropyridine;ABT-59;5-[[(2R)-azetidin-2-yl]methoxy]-2-chloropyridine;Tebanicline(ABT-594);CS-2417;ABT594;ABT 594 | | CAS: | 198283-73-7 | | MF: | C9H11ClN2O | | MW: | 198.65 | | EINECS: | | | Product Categories: | | | Mol File: | 198283-73-7.mol |  |
| | ABT-594 Chemical Properties |
| Melting point | 116-117 °C | | Boiling point | 321.1±22.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | H2O: 2 mg/mL, clear | | pka | 10.05±0.40(Predicted) | | form | powder | | color | white to beige | | Water Solubility | H2O: 2mg/mL, clear | | InChI | 1S/C9H11ClN2O/c10-9-2-1-8(5-12-9)13-6-7-3-4-11-7/h1-2,5,7,11H,3-4,6H2/t7-/m1/s1 | | InChIKey | MKTAGSRKQIGEBH-SSDOTTSWSA-N | | SMILES | Clc1ncc(cc1)OC[C@@H]2NCC2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | STOT SE 3 | | Toxicity | mouse,LD50,intraperitoneal,3794ug/kg (3.794mg/kg),BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLD,European Journal of Pharmacology. Vol. 346, Pg. 23, 1998. |
| | ABT-594 Usage And Synthesis |
| Uses | Analgesic (cholinergic channel modulator). | | Biological Activity | Tebanicline (ABT-594) is a partial agonist at neural nicotinic acetylcholine receptors, binding to both the α3β4 and the α4β2 subtypes. It is a less toxic analog of epibatidine with potent antinociceptive effects. |
| | ABT-594 Preparation Products And Raw materials |
|