|
|
| | 1H-Pyrrole-2-carboxylicacid,4-formyl-,methylester(9CI) Basic information |
| | 1H-Pyrrole-2-carboxylicacid,4-formyl-,methylester(9CI) Chemical Properties |
| Melting point | 124-125° | | Boiling point | 328.5±27.0 °C(Predicted) | | density | 1.305±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 13.66±0.50(Predicted) | | Appearance | Light brown to yellow Solid | | InChI | InChI=1S/C7H7NO3/c1-11-7(10)6-2-5(4-9)3-8-6/h2-4,8H,1H3 | | InChIKey | MIBDQVZPRVDXQP-UHFFFAOYSA-N | | SMILES | N1C=C(C=O)C=C1C(OC)=O |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 1H-Pyrrole-2-carboxylicacid,4-formyl-,methylester(9CI) Usage And Synthesis |
| | 1H-Pyrrole-2-carboxylicacid,4-formyl-,methylester(9CI) Preparation Products And Raw materials |
|