(-)-NORTRACHELOGENIN manufacturers
- (-)-NORTRACHELOGENIN
-
- $1.00 / 1KG
-
2019-12-31
- CAS:34444-37-6
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | (-)-NORTRACHELOGENIN Basic information |
| Product Name: | (-)-NORTRACHELOGENIN | | Synonyms: | (-)-Wikstromol;(3S)-4,5-Dihydro-4β-(4-hydroxy-3-methoxybenzyl)-3-(4-hydroxy-3-methoxybenzyl)-3β-hydroxyfuran-2(3H)-one;(3S,4S)-4,5-Dihydro-3,4-bis(4-hydroxy-3-methoxybenzyl)-3-hydroxyfuran-2(3H)-one;(3S,4S)-4,5-Dihydro-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one;Pinopalustrin;2(3H)-Furanone,dihydro-3-hydroxy-3,4-bis((4-hydroxy-3-methoxyphenyl)methyl)-,(3R-cis);8'-(R)-4,4',8-Trihydroxy-3,3'-dimethoxylignanolide;Dibenzylbutyrolactone | | CAS: | 34444-37-6 | | MF: | C20H22O7 | | MW: | 374.38 | | EINECS: | 200-158-5 | | Product Categories: | | | Mol File: | 34444-37-6.mol |  |
| | (-)-NORTRACHELOGENIN Chemical Properties |
| Boiling point | 609.1±50.0 °C(Predicted) | | density | 1.370±0.06 g/cm3(Predicted) | | form | Solid | | pka | 10.02±0.20(Predicted) | | color | White to off-white | | InChI | InChI=1S/C20H22O7/c1-25-17-8-12(3-5-15(17)21)7-14-11-27-19(23)20(14,24)10-13-4-6-16(22)18(9-13)26-2/h3-6,8-9,14,21-22,24H,7,10-11H2,1-2H3/t14-,20-/m0/s1 | | InChIKey | ZITBJWXLODLDRH-XOBRGWDASA-N | | SMILES | O1C[C@H](CC2=CC=C(O)C(OC)=C2)[C@@](O)(CC2=CC=C(O)C(OC)=C2)C1=O | | LogP | 0.920 (est) |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII |
| | (-)-NORTRACHELOGENIN Usage And Synthesis |
| Uses | Nortrachelogenin ((-)-Wikstromol) from Partrinia scabiosaefolia elicits an apoptotic response in Candida albicans[1]. | | Definition | ChEBI: Nortrachelogenin is a lignan. | | References | [1] Heejeong Lee, et al. (-)-Nortrachelogenin from Partrinia scabiosaefolia elicits an apoptotic response in Candida albicans. FEMS Yeast Res. 2016 May;16(3):fow013. DOI:10.1093/femsyr/fow013 |
| | (-)-NORTRACHELOGENIN Preparation Products And Raw materials |
|