|
|
| | 2-Pentanone-1,1,1,3,3-d5 Basic information |
| Product Name: | 2-Pentanone-1,1,1,3,3-d5 | | Synonyms: | Ethyl(acetone-d5), Methyl-d3 propyl-1,1-d2 ketone;2-Pentanone--d5;2-Pentanone-1,1,1,3,3-d5;2-Pentanone-1,1,1,3,3-d5 | | CAS: | 24313-49-3 | | MF: | C5H5D5O | | MW: | 91.16 | | EINECS: | | | Product Categories: | | | Mol File: | 24313-49-3.mol |  |
| | 2-Pentanone-1,1,1,3,3-d5 Chemical Properties |
| Melting point | -78 °C(lit.) | | Boiling point | 101-105 °C(lit.) | | density | 0.855 g/mL at 25 °C | | Fp | 7 °C | | InChI | 1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3/i2D3,4D2 | | InChIKey | XNLICIUVMPYHGG-PVGOWFQYSA-N | | SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CC |
| Hazard Codes | F,Xn | | Risk Statements | 11-22-36/37/38 | | Safety Statements | 9-16-26-29-33-36/37 | | RIDADR | UN 1249 3/PG 2 | | WGK Germany | 1 | | RTECS | SA7875000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Pentanone-1,1,1,3,3-d5 Usage And Synthesis |
| Uses | 2-Pentanone-1,1,1,3,3-d5 (CAS# 24313-49-3) is a useful isotopically labeled research compound. |
| | 2-Pentanone-1,1,1,3,3-d5 Preparation Products And Raw materials |
|