| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
L-NORADRENALINE HYDROCHLORIDE manufacturers
|
| | L-NORADRENALINE HYDROCHLORIDE Basic information |
| Product Name: | L-NORADRENALINE HYDROCHLORIDE | | Synonyms: | L-ARTERENOL HYDROCHLORIDE;(-)-ARTERENOL HYDROCHLORIDE;L-NOREPINEPHRINE HYDROCHLORIDE;1,2-Benzenediol, 4-[(1R)-2-amino-1-hydroxyethyl]-, hydrochloride (1:1);L-NORADRENALINE HYDROCHLORIDE;aktaminhydrochloride;alpha-(aminomethyl)-3,4-dihydroxy-,hydrochloride,(-)-benzylalcoho;levophedhydrochloride | | CAS: | 329-56-6 | | MF: | C8H11NO3.ClH | | MW: | 205.64 | | EINECS: | 206-345-5 | | Product Categories: | | | Mol File: | 329-56-6.mol |  |
| | L-NORADRENALINE HYDROCHLORIDE Chemical Properties |
| Melting point | ~150 °C (dec.) | | alpha | D25 -40° (c = 6) | | storage temp. | 2-8°C | | solubility | Very soluble in water, slightly soluble in ethanol (96 per cent). It becomes coloured on exposure to air and light. | | form | Solid | | color | X-form-crystals | | InChI | InChI=1S/C8H11NO3.ClH/c9-4-8(12)5-1-2-6(10)7(11)3-5;/h1-3,8,10-12H,4,9H2;1H/t8-;/m0./s1 | | InChIKey | FQTFHMSZCSUVEU-QRPNPIFTSA-N | | SMILES | C1(O)=CC=C([C@@H](O)CN)C=C1O.[H]Cl |
| Hazard Codes | T,C,F | | Risk Statements | 25-34-11 | | Safety Statements | 45-36/37/39-26-16 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | DN6475000 | | F | 3-8-10-23 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral | | Toxicity | LD50 orl-rat: 132 mg/kg AIPTAK 180,155,69 |
| | L-NORADRENALINE HYDROCHLORIDE Usage And Synthesis |
| Chemical Properties | White or brownish-white, crystalline powder. | | Uses | Alpha-adrenoceptor agonist. | | Safety Profile | Poison by ingestion,subcutaneous, and intraduodenal routes. When heated todecomposition it emits very toxic fumes of HCl and NOx. | | in vivo |
Norepinephrine hydrochloride can be used to induce cardiomyopathy[5][6]
Induced Cardiomyopathy Model[5][6] Background Norepinephrine hydrochloride is a potent growth factor for cardiomyocytes. Long-term infusion of subhyperbaric doses of Norepinephrine hydrochloride in animals can cause increases in myocardial mass and left ventricular wall thickness. Norepinephrine hydrochloride activates the Raf-1 kinase/MAP kinase cascade through α1- and β-adrenergic stimulation, and signaling pathways from both receptors synergistically induce cardiomyocyte hypertrophy.
Specific Modeling Methods
Rat: Spragues-Dawley rats adult (6 months old) male
Administration: Continuously injected via an osmotic minipump 100 μg/kg/h or 200 μg/kg/h (Norepinephrine)
Modeling Indicators Molecular changes: Left ventricular Dnmt activity ↑; ROS generation ↑; lactate dehydrogenase release ↑; dystrophin expression ↑; FHL2 protein expression ↓
Gene Expression: Expression of Dnmt1, 3a, and 3b ↑; mRNA expression of fetal genes ANP, BNP, and βMHC in left ventricle ↑
Phenotypic observation: Myocardial infarction area ↑; blood pressure continues to rise; left ventricular mass ↑; left ventricular development pressure ↓; cardiac contractility ↓. Cardiac hypertrophy.
Correlated Product(s): / Opposite Product(s): 5-Aza-2’-deoxycytidine (HY-A0004), Prazosin (HY-B0193), Propranolol (HY-B0573B) | | IC 50 | α1-adrenergic receptor; α2-adrenergic receptor; Beta-1 adrenergic receptor; Microbial Metabolite; Human Endogenous Metabolite | | Purification Methods | Recrystallise arterenol from isoPrOH and store it in the dark as it is oxidised under light (see preceding entry). [Tullar J Am Chem Soc 70 2067 1948, Beilstein 13 III 2382.] |
| | L-NORADRENALINE HYDROCHLORIDE Preparation Products And Raw materials |
|