| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:ChorisMic acid froM Enterobacter aerogenes
CAS:617-12-9
Purity:>=80% Package:100MG,10MG,25MG,5MG
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:Chorismic acid
CAS:617-12-9
Purity:98% Remarks:B35826
|
CHORISMIC ACID manufacturers
- CHORISMIC ACID
-
-
2025-12-01
- CAS:617-12-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | CHORISMIC ACID Basic information |
| Product Name: | CHORISMIC ACID | | Synonyms: | CHORISMIC ACID;TRANS-3-[(1-CARBOXYETHENYL)OXY]-4-HYDROXY-1,5-CYCLOHEXADIENE-1-CARBOXYLIC ACID;(-)-Chorismate;(3R)-3β-(1-Carboxyethenyloxy)-4α-hydroxy-1,5-cyclohexadiene-1-carboxylic acid;CHORISMIC ACID FREE ACID FROM &;chorismic acid from enterobacter aerogenes;(3R,4R)-3-[(1-Carboxyethenyl)oxy]-4-hydroxy-1,5-cyclohexadiene-1-carboxylic acid;2-[(3-Carboxy-6β-hydroxy-2,4-cyclohexadiene-1α-yl)oxy]acrylic acid | | CAS: | 617-12-9 | | MF: | C10H10O6 | | MW: | 226.18 | | EINECS: | | | Product Categories: | | | Mol File: | 617-12-9.mol |  |
| | CHORISMIC ACID Chemical Properties |
| Melting point | 105-108° (dec) | | alpha | D21 -274° (c = 0.16 in water) | | Boiling point | 556.1±50.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 3.59±0.11(Predicted) | | form | powder | | InChI | 1S/C10H10O6/c1-5(9(12)13)16-8-4-6(10(14)15)2-3-7(8)11/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/t7-,8-/m1/s1 | | InChIKey | WTFXTQVDAKGDEY-HTQZYQBOSA-N | | SMILES | O[C@@H]1C=CC(=C[C@H]1OC(=C)C(O)=O)C(O)=O |
| Hazard Codes | T | | Risk Statements | 45-20/21/22-36/37/38-63 | | Safety Statements | 53-23-36/37/39-45 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 1B
Eye Irrit. 2
Repr. 2
Skin Irrit. 2
STOT SE 3 |
| | CHORISMIC ACID Usage And Synthesis |
| Uses | Chorismic acid is a metabolite generally used in the study of chorismate-prephenate rearrangement and to synthesize chorismate derivatives. | | Definition | ChEBI: The (3R,4R)-stereoisomer of 5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid. |
| | CHORISMIC ACID Preparation Products And Raw materials |
|