|
|
| | Ethyl 4-(N,N-diethylamino)benzoate Basic information |
| Product Name: | Ethyl 4-(N,N-diethylamino)benzoate | | Synonyms: | ETHYL P-DIETHYLAMINOBENZOATE;P-DIETHYLAMINOBENZOIC ACID ETHYL ESTER;RARECHEM AL BI 0080;TIMTEC-BB SBB009978;ethyl 4-diethylaminobenzoate;4-Diethylaminobenzoic acid ethyl ester;p-Diethylaminoethylbenzoate;Benzoic acid, 4-(diethylamino)-, ethyl ester | | CAS: | 10287-54-4 | | MF: | C13H19NO2 | | MW: | 221.3 | | EINECS: | 233-635-9 | | Product Categories: | Aromatic Esters | | Mol File: | 10287-54-4.mol |  |
| | Ethyl 4-(N,N-diethylamino)benzoate Chemical Properties |
| Melting point | 39-43°C | | Boiling point | 362.36°C (rough estimate) | | density | 1.0451 (rough estimate) | | refractive index | 1.5175 (estimate) | | pka | 4.13±0.32(Predicted) | | form | solid | | InChI | 1S/C13H19NO2/c1-4-14(5-2)12-9-7-11(8-10-12)13(15)16-6-3/h7-10H,4-6H2,1-3H3 | | InChIKey | XPKFLEVLLPKCIW-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1ccc(cc1)N(CC)CC | | CAS DataBase Reference | 10287-54-4(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 4-(N,N-diethylamino)benzoate Usage And Synthesis |
| | Ethyl 4-(N,N-diethylamino)benzoate Preparation Products And Raw materials |
|