| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Sodium octanoate-1-13C Basic information |
| Product Name: | Sodium octanoate-1-13C | | Synonyms: | SODIUM OCTANOATE-1-13C, 99 ATOM % 13C;octanoic acid-1-13c sodium salt;Octanoic-1-13C acid sodium salt;Sodium Octoate-1-13C;13C Labeled sodium octanoate;Sodium caprylate-1-13C;Octanoic-1-13C acid sodium salt;Sodium Octanoate-13C | | CAS: | 201612-61-5 | | MF: | C8H16O2.Na | | MW: | 168.19 | | EINECS: | | | Product Categories: | | | Mol File: | 201612-61-5.mol |  |
| | Sodium octanoate-1-13C Chemical Properties |
| Melting point | >300 °C(lit.) | | storage temp. | Store at -20°C | | form | solid | | InChI | 1S/C8H16O2.Na/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1/i8+1; | | InChIKey | BYKRNSHANADUFY-IYWRZBIASA-M | | SMILES | [Na+].CCCCCCC[13C]([O-])=O | | CAS Number Unlabeled | 01/06/1984 |
| WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | Sodium octanoate-1-13C Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Octanoate-13C (sodium) is a 13C-labeled Fmoc-Gly-OH[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-223. DOI:10.1080/02688697.2018.1500521 |
| | Sodium octanoate-1-13C Preparation Products And Raw materials |
|