5-tert-Butyl-2-(4-methoxy-phenyl)-2H-pyrazol-3-ylamine manufacturers
|
| | 5-tert-Butyl-2-(4-methoxy-phenyl)-2H-pyrazol-3-ylamine Basic information |
| Product Name: | 5-tert-Butyl-2-(4-methoxy-phenyl)-2H-pyrazol-3-ylamine | | Synonyms: | BUTTPARK 30\09-73;1H-Pyrazol-5-aMine, 3-(1,1-diMethylethyl)-1-(4-Methoxyphenyl)-;3-(tert-Butyl)-1-(4-Methoxyphenyl)-1H-pyrazol-5-aMine;3-tert-butyl-1-(4-methoxyphenyl)-1H-pyrazole;5-tert-butyl-2-(4-methoxyphenyl)-3-pyrazolamine;JR-13717, 3-Tert-butyl-1-(4-methoxyphenyl)-1H-pyrazol-5-amine, 97%;5-tert-butyl-2-(4-methoxyphenyl)pyrazol-3-amine;5-tert-Butyl-2-(4-methoxy-phenyl)-2H-pyrazol-3-ylamine | | CAS: | 227623-26-9 | | MF: | C14H19N3O | | MW: | 245.32 | | EINECS: | | | Product Categories: | | | Mol File: | 227623-26-9.mol |  |
| | 5-tert-Butyl-2-(4-methoxy-phenyl)-2H-pyrazol-3-ylamine Chemical Properties |
| Boiling point | 391.3±37.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 4.29±0.10(Predicted) | | form | solid | | InChI | 1S/C14H19N3O/c1-14(2,3)12-9-13(15)17(16-12)10-5-7-11(18-4)8-6-10/h5-9H,15H2,1-4H3 | | InChIKey | BUNGLKKPGWGZDC-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)-n2nc(cc2N)C(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-tert-Butyl-2-(4-methoxy-phenyl)-2H-pyrazol-3-ylamine Usage And Synthesis |
| | 5-tert-Butyl-2-(4-methoxy-phenyl)-2H-pyrazol-3-ylamine Preparation Products And Raw materials |
|