1-deazaadenosine manufacturers
|
| | 1-deazaadenosine Basic information |
| Product Name: | 1-deazaadenosine | | Synonyms: | 1-deazaadenosine;7-Amino-3-(β-D-ribofuranosyl)-3H-imidazo[4,5-b]pyridine;3H-IMidazo[4,5-b]pyridin-7-aMine, 3-b-D-ribofuranosyl-;3-beta-D-Ribofuranosyl-3H-imidazo[4,5-b]pyridin-7-amine;3-β-D-Ribofuranosyl-3H-imidazo[4,5-b]pyridin-7-amine;Deazaadenosine, 1-;3H-Imidazo[4,5-b]pyridin-7-amine, 3-β-D-ribofuranosyl-;1 Deazaadenosine,1Deazaadenosine | | CAS: | 14432-09-8 | | MF: | C11H14N4O4 | | MW: | 266.25326 | | EINECS: | | | Product Categories: | | | Mol File: | 14432-09-8.mol |  |
| | 1-deazaadenosine Chemical Properties |
| Melting point | 263-264 °C (decomp)(Solv: water (7732-18-5)) | | Boiling point | 674.6±65.0 °C(Predicted) | | density | 1.90±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble to 25 mM in DMSO | | form | Powder | | pka | 13.21±0.70(Predicted) | | color | White to off-white | | InChI | InChI=1/C11H14N4O4/c12-5-1-2-13-10-7(5)14-4-15(10)11-9(18)8(17)6(3-16)19-11/h1-2,4,6,8-9,11,16-18H,3H2,(H2,12,13)/t6-,8-,9-,11-/s3 | | InChIKey | NVUDDRWKCUAERS-SOMIAQKHNA-N | | SMILES | C12N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C=NC1=C(N)C=CN=2 |&1:2,4,7,9,r| |
| | 1-deazaadenosine Usage And Synthesis |
| Uses | 1-Deazaadenosine is a potent Adenosine deaminase (ADA) inhibitor with a Ki value of 0.66 μM. 1-Deazaadenosine exhibits anti-cancer activities in vitro and has the potential to be a chemotherapy agent for lymphoproliferative disorders[1][2]. | | storage | Store at +4°C | | References | [1] Cristalli G, et al.Adenosine deaminase inhibitors: Structure-activity relationships in 1-deazaadenosine and erythro-9-(2-hydroxy-3-nonyl)adenine analogues. Drug Dev.Res.
[2] Cristalli G, et al.Improved synthesis and antitumor activity of 1-deazaadenosine.J Med Chem. 1987 Sep;30(9):1686-8. DOI:10.1021/jm00392a029 |
| | 1-deazaadenosine Preparation Products And Raw materials |
|