| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Benzyl-alpha-13C-alpha alpha-d2 alcohol Basic information |
| Product Name: | Benzyl-alpha-13C-alpha alpha-d2 alcohol | | Synonyms: | BENZYL-ALPHA-13C-ALPHA,ALPHA-D2 ALCOHOL, 99 ATOM % 13C, 98 ATOM % D;99atom%13c98atom%d;benzyl alcohol-α-13c-α,α-d2;Benzyl alcohol-alpha-13C-alpha,alpha-d2;Benzyl alcohol-alpha-13C-alpha,alpha-d2 99 atom % 13C, 98 atom % D;Benzyl alcohol-α-13C-α,α-d2;Benzyl alcohol-α-13C-α,α-d2, CAS 285977-71-1;Benzyl-alpha-13C-alpha alpha-d2 alcohol | | CAS: | 285977-71-1 | | MF: | C7H6D2O | | MW: | 111.16 | | EINECS: | | | Product Categories: | Alphabetical Listings;B;Stable Isotopes | | Mol File: | 285977-71-1.mol |  |
| | Benzyl-alpha-13C-alpha alpha-d2 alcohol Chemical Properties |
| Melting point | -16--13 °C (lit.) | | Boiling point | 203-205 °C (lit.) | | density | 1.074 g/mL at 25 °C | | refractive index | n20/D 1.54(lit.) | | Fp | 201 °F | | InChI | 1S/C7H8O/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2/i6+1D2 | | InChIKey | WVDDGKGOMKODPV-OCAPALNOSA-N | | SMILES | [2H][13C]([2H])(O)c1ccccc1 |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 26 | | RIDADR | UN 3334 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2 |
| | Benzyl-alpha-13C-alpha alpha-d2 alcohol Usage And Synthesis |
| Uses | Benzyl alcohol-α-13C-α,α-d2 is the 13C-labeled Benzyl alcohol. Benzyl alcohol is an aromatic alcohol; a colorless liquid with a mild pleasant aromatic odor. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | Benzyl-alpha-13C-alpha alpha-d2 alcohol Preparation Products And Raw materials |
|