|
|
| | LEAD(II) ACETYLACETONATE Basic information |
| Product Name: | LEAD(II) ACETYLACETONATE | | Synonyms: | 2,4-PENTANEDIONE, LEAD(II) DERIVATIVE;Leadacetylacetonateminwhitepowder;Leadpentanedionate;bis(pentane-2,4-dionato-O,O')lead;LEAD(II) ACETYLACETONATE, TECH.;Bis[2,4-pentanedionato] lead;Plumbous acetylacetonate;LEAD ACETYLACETONATE | | CAS: | 15282-88-9 | | MF: | C10H14O4Pb | | MW: | 405.42 | | EINECS: | 239-323-9 | | Product Categories: | metal beta-diketonate complexes | | Mol File: | 15282-88-9.mol |  |
| | LEAD(II) ACETYLACETONATE Chemical Properties |
| Melting point | 141-144 °C(lit.) | | Boiling point | 120°C 0,01mm | | form | Powder | | color | white | | Water Solubility | Soluble in toluene. Insoluble in water. | | Sensitive | Hygroscopic | | Exposure limits | NIOSH: IDLH 100 mg/m3; TWA 0.050 mg/m3 | | Stability: | hygroscopic | | InChI | 1S/2C5H8O2.Pb/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; | | InChIKey | UNNUWSQNTAFLDC-FDGPNNRMSA-L | | SMILES | CC(=O)\C=C(\C)O[PbH2]O\C(C)=C/C(C)=O |
| Hazard Codes | T,N | | Risk Statements | 61-20/22-33-50/53-62 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 2291 6.1/PG 3 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Repr. 1A
STOT RE 2 |
| | LEAD(II) ACETYLACETONATE Usage And Synthesis |
| Chemical Properties | white powder(s); hygroscopic [STR93] | | Uses | Used as pharmaceutical intermediate. | | reaction suitability | core: lead
reagent type: catalyst |
| | LEAD(II) ACETYLACETONATE Preparation Products And Raw materials |
|