|
|
| | liriodenine Basic information |
| Product Name: | liriodenine | | Synonyms: | Iiriodenine;liriodenine;8H-Benzo[G]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one;Noraporphin-7-one, 4,5,6,6A-tetradehydro-1,2-(methylenedioxy)-;Nsc93681;Oxoushinsunin;Spermatheridin;Spermatheridine | | CAS: | 475-75-2 | | MF: | C17H9NO3 | | MW: | 275.26 | | EINECS: | | | Product Categories: | | | Mol File: | 475-75-2.mol |  |
| | liriodenine Chemical Properties |
| Melting point | 282°C | | Boiling point | 531.0±19.0 °C(Predicted) | | density | 1.501±0.06 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 2.67±0.20(Predicted) | | color | Yellow | | InChI | InChI=1S/C17H9NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-7H,8H2 | | InChIKey | MUMCCPUVOAUBAN-UHFFFAOYSA-N | | SMILES | N1C2=C3C(=C4C(=CC3=CC=1)OCO4)C1=CC=CC=C1C2=O |
| | liriodenine Usage And Synthesis |
| Description | Isolated from the heartwood extract of Liriodendron tulip/era, this base may be
purified by crystallization from CHCI3. It contains one methylenedioxy group
and a keto group, forming a crystalline oxime, m.p. 271°C. The structure has
been confirmed by synthesis, the synthetic alkaloid having a higher melting
point of 287°C. | | Uses | Liriodenine is an isoquinoline alkaloid found in extracts of medicinal Asian vegetation such as Michelia alba and Liriodendron chinense. | | Definition | ChEBI: An oxoaporphine alkaloid that is 4,5,6,6a-tetradehydronoraporphin-7-one substituted by a methylenedioxy group across positions 1 and 2. It is isolated from Annona glabra and has been shown to exhibit antimicrobial and cytotoxic activities. | | target | p53 | Caspase | Bcl-2/Bax | Sodium Channel | Potassium Channel | Topoisomerase | cAMP | | References | Buchanan, Dickey.,J. Org. Chern., 25, 1389 (1960)
Taylor., Tetrahedron, 14,42 (1961) |
| | liriodenine Preparation Products And Raw materials |
|