| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Malathion-d10
CAS:347841-48-9
Remarks:CS-C-01011
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Malathion-d10
CAS:347841-48-9
Purity:99% HPLC Package:10mg;100mg;1g
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:Malathion-d10
CAS:347841-48-9
Purity:98%+ Package:5g;1g;500mg;100mg;25mg;10mg Remarks:Pesticides and Pesticide Metabolites
|
| Company Name: |
Qingdao Tenglong microwave technology co., LTD.
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:MALATHION (D10, 99%) 100 UG/ML IN NONANE
CAS:347841-48-9
Purity:98% Package:1.2ML Remarks:DLM-4476-1.2
|
MALATHION (D10) manufacturers
- Malathion-D10
-
-
2026-05-11
- CAS:347841-48-9
- Purity:
- Supply Ability: 10g
|
| | MALATHION (D10) Basic information |
| Product Name: | MALATHION (D10) | | Synonyms: | MALATHION (D10);MALATHION-D10 (DIETHYL-D10);bis(1,1,2,2,2-pentadeuterioethyl) 2-dimethoxyphosphinothioylsulfanylbutanedioate;D10-Malathion;Malathion-d10 (diethyl-d10) in isooctane;Malathion-(diethyl-d10);Malathion (D??, 99%) 100 μg/mL in nonane;Malathion-D10 (Standard) | | CAS: | 347841-48-9 | | MF: | C10H19O6PS2 | | MW: | 330.35 | | EINECS: | | | Product Categories: | | | Mol File: | 347841-48-9.mol |  |
| | MALATHION (D10) Chemical Properties |
| storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Major Application | agriculture
environmental | | InChI | 1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h8H,5-7H2,1-4H3/i1D3,2D3,5D2,6D2 | | InChIKey | JXSJBGJIGXNWCI-JKSUIMTKSA-N | | SMILES | [P](=S)(SC(CC(=O)OC(C([2H])([2H])[2H])([2H])[2H])C(=O)OC(C([2H])([2H])[2H])([2H])[2H])(OC)OC | | EPA Substance Registry System | Butanedioic acid, [(dimethoxyphosphinothioyl)thio]-, di(ethyl-d5) ester (347841-48-9) |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 |
| | MALATHION (D10) Usage And Synthesis |
| Uses | Malathion (Diethyl-d10) is used as one of the substances for the clean-up step in post-harvest pesticide residue analysis. |
| | MALATHION (D10) Preparation Products And Raw materials |
|