| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | N-[2-(Fmoc-amino)-ethyl]glycine tert-butyl ester hydrochloride Basic information |
| Product Name: | N-[2-(Fmoc-amino)-ethyl]glycine tert-butyl ester hydrochloride | | Synonyms: | TERT-BUTYL [2-(FMOC-AMINO)ETHYLAMINO]ACETATE HYDROCHLORIDE;N-[2-(FMOC-AMINO)-ETHYL]-GLY-O-TBU HCL;N-[2-(Fmoc-amino)-ethyl]glycine tert-butylester hydrochloride, tert-Butyl [2-(Fmoc-amino)ethylamino]acetate hydrochloride;n-[2-(fmoc-amino)-ethyl]-gly-o-tbuHClHPLC;n-[2-(fmoc-amino)-ethyl]-gly-o-tbuhydrochloridehplc;N-[2-(Fmoc-amino)-ethyl]-Gly-o-Tbu hydrochloride;N-[2-(Fmoc-amino)-ethyl]glycinetert-butylester hydrochloride≥ 98% (HPLC);tert-Butyl 2-((2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)ethyl)amino)acetate hydrochloride | | CAS: | 169396-88-7 | | MF: | C23H29ClN2O4 | | MW: | 432.94 | | EINECS: | | | Product Categories: | | | Mol File: | 169396-88-7.mol | ![N-[2-(Fmoc-amino)-ethyl]glycine tert-butyl ester hydrochloride Structure](CAS/GIF/169396-88-7.gif) |
| | N-[2-(Fmoc-amino)-ethyl]glycine tert-butyl ester hydrochloride Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | color | white | | BRN | 7240947 | | Major Application | peptide synthesis | | InChI | 1S/C23H28N2O4.ClH/c1-23(2,3)29-21(26)14-24-12-13-25-22(27)28-15-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20;/h4-11,20,24H,12-15H2,1-3H3,(H,25,27);1H | | InChIKey | LVIQOMHZCMGMIG-UHFFFAOYSA-N | | SMILES | Cl.CC(C)(C)OC(=O)CNCCNC(=O)OCC1c2ccccc2-c3ccccc13 |
| WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | N-[2-(Fmoc-amino)-ethyl]glycine tert-butyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Building block for preparing FMOC-protected PNA (Peptide Nucleic Acid) monomers. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-[2-(Fmoc-amino)-ethyl]glycine tert-butyl ester hydrochloride Preparation Products And Raw materials |
|