| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | ethyl 4-chloro-6-methoxy-quinoline-3-carboxylate Basic information |
| Product Name: | ethyl 4-chloro-6-methoxy-quinoline-3-carboxylate | | Synonyms: | 4-Chloro-6-methoxy-quinoline-3-carboxylic acid ethyl ester;Ethyl 4-chloro-6-methoxyquinoline-3-carboxylate;3-Quinolinecarboxylic acid, 4-chloro-6-methoxy-, ethyl ester;3-Carbethoxy-4-chloro-6-methoxyquinoline | | CAS: | 22931-71-1 | | MF: | C13H12ClNO3 | | MW: | 265.69 | | EINECS: | | | Product Categories: | | | Mol File: | 22931-71-1.mol |  |
| | ethyl 4-chloro-6-methoxy-quinoline-3-carboxylate Chemical Properties |
| Melting point | 88-90℃ | | storage temp. | Store at room temperature | | form | solid | | Appearance | Light brown to brown Solid | | InChI | 1S/C13H12ClNO3/c1-3-18-13(16)10-7-15-11-5-4-8(17-2)6-9(11)12(10)14/h4-7H,3H2,1-2H3 | | InChIKey | QURGQUFEJWWDRF-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1cnc2ccc(OC)cc2c1Cl |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | ethyl 4-chloro-6-methoxy-quinoline-3-carboxylate Usage And Synthesis |
| Uses | Ethyl 4-chloro-6-methoxyquinoline-3-carboxylate is an important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. |
| | ethyl 4-chloro-6-methoxy-quinoline-3-carboxylate Preparation Products And Raw materials |
|