Cubebinolide manufacturers
- Cubebinolide
-
-
2026-07-10
- CAS:26543-89-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 10000kgS
|
| | Cubebinolide Basic information |
| Product Name: | Cubebinolide | | Synonyms: | Cubebinolide;(-)-Hinokinin;(3R)-3α,4β-Bis(1,3-benzodioxole-5-ylmethyl)tetrahydrofuran-2-one;(3R,4R)-3,4-Bis(1,3-benzodioxol-5-ylmethyl)-4,5-dihydrofuran-2(3H)-one;3α,4β-Dipiperonyltetrahydrofuran-2-one;2(3H)-Furanone,3,4-bis(1,3-benzodioxol-5-ylmethyl)dihydro-, (3R,4R)-;(3R,4R)-3,4-Bis(benzo[d][1,3]dioxol-5-ylmethyl)dihydrofuran-2(3H)-one;Dihydroisohibalactone | | CAS: | 26543-89-5 | | MF: | C20H18O6 | | MW: | 354.35 | | EINECS: | | | Product Categories: | | | Mol File: | 26543-89-5.mol |  |
| | Cubebinolide Chemical Properties |
| Melting point | 63-64 °C | | Boiling point | 549.0±19.0 °C(Predicted) | | density | 1.388±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | form | Solid | | color | White to off-white | | InChI | 1S/C20H18O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15H,5-6,9-11H2/t14-,15+/m0/s1 | | InChIKey | DDWGQGZPYDSYEL-LSDHHAIUSA-N | | SMILES | O1C[C@@H]([C@H](C1=O)Cc4cc5c(cc4)OCO5)Cc2cc3c(cc2)OCO3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | Cubebinolide Usage And Synthesis |
| Uses | Hinokinin (Standard) is the analytical standard of Hinokinin. This product is intended for research and analytical applications. Hinokinin (Compound 1) is a compound isolated from the stems of Hypoestes aristate. Hinokinin exhibits moderate activity of HIV-1 protease enzyme. | | Definition | ChEBI: A lignan that is dihydrofuran-2(3H)-one (gamma-butyrolactone) substituted by a 3,4-methylenedioxybenzyl group at positions 3 and 4 (the 3R,4R-diastereoisomer). |
| | Cubebinolide Preparation Products And Raw materials |
|