|
|
| | Dimethylphenylsilanol, Basic information |
| Product Name: | Dimethylphenylsilanol, | | Synonyms: | 1,2-DIETHOXYTETRAMETHYLDISILANE;Disilane,1,2-diethoxy-1,1,2,2-tetramethyl-;1,2-Diethoxy-1,1,2,2-tetramethyldisilane 97% | | CAS: | 18419-84-6 | | MF: | C8H22O2Si2 | | MW: | 206.43 | | EINECS: | | | Product Categories: | Chemical Synthesis;Disilanes;Organometallic Reagents;Organosilicon | | Mol File: | 18419-84-6.mol |  |
| | Dimethylphenylsilanol, Chemical Properties |
| Boiling point | 84℃/50mmHg | | density | 0.836g/mLat 25℃ | | refractive index | n20/D 1.423 | | Fp | 42°C | | Specific Gravity | 0.8499 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C8H22O2Si2/c1-7-9-11(3,4)12(5,6)10-8-2/h7-8H2,1-6H3 | | InChIKey | GWIVSKPSMYHUAK-UHFFFAOYSA-N | | SMILES | CCO[Si](C)(C)[Si](C)(C)OCC |
| Risk Statements | 10 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | Dimethylphenylsilanol, Usage And Synthesis |
| Uses | Disilane reagent used to prepare dimethylsilanol cross-coupling partners.1 |
| | Dimethylphenylsilanol, Preparation Products And Raw materials |
|