|
|
| | 2-(4-Fluorophenyl)-propanedioic acid, 1,3-mdiethyl ester Basic information |
| | 2-(4-Fluorophenyl)-propanedioic acid, 1,3-mdiethyl ester Chemical Properties |
| Boiling point | 268.5±25.0 °C(Predicted) | | density | 1.231±0.06 g/cm3(Predicted) | | pka | 11.49±0.46(Predicted) | | form | solid | | InChI | 1S/C11H11FO4/c1-15-10(13)9(11(14)16-2)7-3-5-8(12)6-4-7/h3-6,9H,1-2H3 | | InChIKey | JWJAHPXFKKPJRD-UHFFFAOYSA-N | | SMILES | O=C(OC)C(C1=CC=C(F)C=C1)C(OC)=O || COC(C(C(OC)=O)C1=CC=C(F)C=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-(4-Fluorophenyl)-propanedioic acid, 1,3-mdiethyl ester Usage And Synthesis |
| | 2-(4-Fluorophenyl)-propanedioic acid, 1,3-mdiethyl ester Preparation Products And Raw materials |
|