| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Cyano-2-(trifluoromethoxy)phenylboronic acid Basic information |
| Product Name: | 5-Cyano-2-(trifluoromethoxy)phenylboronic acid | | Synonyms: | 5-Cyano-2-(trifluoromethoxy)phenylboronic acid;5-Cyano-2-(trifluoroMethoxy)benzeneboronic acid, 97%;Boronic acid, B-[5-cyano-2-(trifluoromethoxy)phenyl]-;5-Cyano-2-(trifluoromethoxy)phenylboronic acid（contains varying amounts of Anhydride）;(5-Cyano-2-(trifluoromethoxy)phenyl)boronic acid - [C90140] | | CAS: | 1072946-64-5 | | MF: | C8H5BF3NO3 | | MW: | 230.94 | | EINECS: | | | Product Categories: | | | Mol File: | 1072946-64-5.mol |  |
| | 5-Cyano-2-(trifluoromethoxy)phenylboronic acid Chemical Properties |
| storage temp. | 2-8°C | | form | Solid | | Appearance | White to off-white Solid | | InChI | 1S/C8H5BF3NO3/c10-8(11,12)16-7-2-1-5(4-13)3-6(7)9(14)15/h1-3,14-15H | | InChIKey | SZPKBNMEIASWNB-UHFFFAOYSA-N | | SMILES | FC(F)(F)OC1=CC=C(C#N)C=C1B(O)O |
| HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 5-Cyano-2-(trifluoromethoxy)phenylboronic acid Usage And Synthesis |
| Uses | 5-Cyano-2-(trifluoromethoxy)phenylboronic Acid is a derivative of Phenylboronic Acid (P319590), a compound used in the organic synthesis of various pharmaceutical goods. |
| | 5-Cyano-2-(trifluoromethoxy)phenylboronic acid Preparation Products And Raw materials |
|