| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile Basic information |
| Product Name: | 2-chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile | | Synonyms: | 2-chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile;2-Chloro-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile;3-Pyridinecarbonitrile, 2-chloro-6-methyl-4-(trifluoromethyl)-;2-Chloro-4-(trifluoromethyl)-6-methylnicotinonitrile;2-chloro-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile - [C82513] | | CAS: | 13600-48-1 | | MF: | C8H4ClF3N2 | | MW: | 220.58 | | EINECS: | | | Product Categories: | | | Mol File: | 13600-48-1.mol |  |
| | 2-chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile Chemical Properties |
| Boiling point | 85 °C | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.69±0.10(Predicted) | | form | oil | | color | Pale yellow | | InChI | InChI=1S/C8H4ClF3N2/c1-4-2-6(8(10,11)12)5(3-13)7(9)14-4/h2H,1H3 | | InChIKey | LNJOJFNFYGSCCR-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=CC(C(F)(F)F)=C1C#N |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2-chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile Usage And Synthesis |
| Uses | 2-Chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile is used in preparation of heterocyclic derivatives as DNA polymerase theta inhibitors. |
| | 2-chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile Preparation Products And Raw materials |
|