| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate Basic information |
| Product Name: | tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate | | Synonyms: | tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate;(1S,6R)-3,8-diaza-bicyclo[4.2.0]octane-3-carboxylic acid tert-butyl ester;(1S,6R)-tert-Butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate;(1S,6R)-3,8-Diazabicyclo[4.2.0]octane-3-carboxylic acid 1,1-dimethylethyl ester;(1S,6R)-3-Boc-3,8-diazabicyclo[4.2.0]octane;tert-butyl (1S,6R)-3,8-diazabicyclo[4.2.0]octane-3-carboxylate;3,8-Diazabicyclo[4.2.0]octane-3-carboxylic acid, 1,1-dimethylethyl ester, (1S,6R)- | | CAS: | 370881-96-2 | | MF: | C11H20N2O2 | | MW: | 212.29 | | EINECS: | | | Product Categories: | | | Mol File: | 370881-96-2.mol | ![tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate Structure](CAS/GIF/370881-96-2.gif) |
| | tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate Chemical Properties |
| Boiling point | 295.4±13.0 °C(Predicted) | | density | 1.076±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 10.81±0.20(Predicted) | | InChI | InChI=1S/C11H20N2O2/c1-11(2,3)15-10(14)13-5-4-8-6-12-9(8)7-13/h8-9,12H,4-7H2,1-3H3/t8-,9-/m1/s1 | | InChIKey | VGJOEEIXDPWTAZ-RKDXNWHRSA-N | | SMILES | [C@@]12([H])[C@@]([H])(CN1)CCN(C(OC(C)(C)C)=O)C2 |
| | tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate Usage And Synthesis |
| | tert-butyl 3,8-diazabicyclo[4.2.0]octane-3-carboxylate Preparation Products And Raw materials |
|