| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
|
| | 4-tert-Butylcyclohexylamine, cis Basic information |
| Product Name: | 4-tert-Butylcyclohexylamine, cis | | Synonyms: | CIS-1-AMINO-4-TERT-BUTYLCYCLOHEXANE;CIS-4-TERT-BUTYL-1-CYCLOHEXANAMINE;CYCLOHEXANAMINE, 4-(1,1-DIMETHYLETHYL)-, CIS-;Cis-1-Amino-4-tert-butylcyclohexylamine;Cis-1-Amino-4-Tert-Butylcyclohexane(WXC00783);cis-(1s,4s)-4-(tert-Butyl)cyclohexan-1-amine;cis-4-tert-Butyl-cyclohexylamine;(1s,4s)-4-(tert-butyl)cyclohexanamine | | CAS: | 2163-33-9 | | MF: | C10H21N | | MW: | 155.28 | | EINECS: | | | Product Categories: | | | Mol File: | 2163-33-9.mol |  |
| | 4-tert-Butylcyclohexylamine, cis Chemical Properties |
| Boiling point | 90 °C(Press: 15 Torr) | | density | 0.861±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 10.58±0.70(Predicted) | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C10H21N/c1-10(2,3)8-4-6-9(11)7-5-8/h8-9H,4-7,11H2,1-3H3/t8-,9+ | | InChIKey | BGNLXETYTAAURD-DTORHVGOSA-N | | SMILES | [C@@H]1(N)CC[C@H](C(C)(C)C)CC1 |
| | 4-tert-Butylcyclohexylamine, cis Usage And Synthesis |
| | 4-tert-Butylcyclohexylamine, cis Preparation Products And Raw materials |
|