|
|
| | N,N-Diglycidyl-4-glycidyloxyaniline Basic information |
| Product Name: | N,N-Diglycidyl-4-glycidyloxyaniline | | Synonyms: | N-[4-(oxiranylmethoxy)phenyl]-N-(oxiranylmethyl)-Oxiranemethanamine;Oxiranemethanamine, N-[4-(oxiranylmethoxy)phenyl]-N-(oxiranylmethyl)-;p-(Diglycidylamino)phenyl glycidyl ether;p-Aminophenol triglycidyl ether;tk12759;4GLYCIDYLOXYNNDIGLYCIDYLANILINE;p-(2,3-Epoxypropoxy)-N,N-bis(2,3-epoxypropyl)anilin;2,2'-[[[4-[(Oxirane-2-yl)methoxy]phenyl]imino]bismethylene]bisoxirane | | CAS: | 5026-74-4 | | MF: | C15H19NO4 | | MW: | 277.32 | | EINECS: | 225-716-2 | | Product Categories: | Epoxide Monomers;Monomers;Polymer Science | | Mol File: | 5026-74-4.mol |  |
| | N,N-Diglycidyl-4-glycidyloxyaniline Chemical Properties |
| Boiling point | 420.18°C (rough estimate) | | density | 1.22 g/mL at 25 °C(lit.) | | vapor pressure | 0Pa at 25℃ | | refractive index | n20/D 1.567(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | liquid | | pka | 4.78±0.50(Predicted) | | Appearance | Colorless to light yellow Liquid | | Water Solubility | 3.34g/L at 20℃ | | InChI | InChI=1S/C15H19NO4/c1-3-12(17-9-15-10-20-15)4-2-11(1)16(5-13-7-18-13)6-14-8-19-14/h1-4,13-15H,5-10H2 | | InChIKey | AHIPJALLQVEEQF-UHFFFAOYSA-N | | SMILES | O1CC1CN(C1=CC=C(OCC2CO2)C=C1)CC1CO1 | | LogP | 0.871 | | CAS DataBase Reference | 5026-74-4(CAS DataBase Reference) | | NIST Chemistry Reference | N,N,N-Glycidyl p-aminophenol(5026-74-4) | | EPA Substance Registry System | 4-(Diglycidylamino)phenyl glycidyl ether (5026-74-4) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-40-43 | | Safety Statements | 23-26-36 | | WGK Germany | 2 | | RTECS | RR0504000 | | TSCA | TSCA listed | | HS Code | 29221990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Muta. 2
Skin Sens. 1
STOT RE 2 | | Toxicity | LD50 oral in hamster: 2739mg/kg |
| | N,N-Diglycidyl-4-glycidyloxyaniline Usage And Synthesis |
| Chemical Properties | Brown viscous liquid | | Uses | N,N-Diglycidyl-4-glycidyloxyaniline can be used:- As a precursor to synthesize rigid-flexible epoxy shape memory polymers through thiol-epoxy click-reaction. It helps to enhance the mechanical properties of the epoxy material.
- As a cross linker to synthesize high molecular weight redox polymer to fabricate electrochemical sensors for glucose monitoring devices.
- As a precursor to synthesize amine sorbent pellets for CO2 capture.
| | Safety Profile | Moderately toxic ingestion. Mutation data reported. Whenheated to decomposition it emits toxic vapors of NOxí. |
| | N,N-Diglycidyl-4-glycidyloxyaniline Preparation Products And Raw materials |
|