- Ribostamycin sulfate
-
- $1.00
-
2026-03-20
- CAS:53797-35-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | Ribostamycin sulfate Basic information |
| | Ribostamycin sulfate Chemical Properties |
| Melting point | 175-180 C | | alpha | D20 +39° (c = 1) | | Fp | >110°(230°F) | | storage temp. | Inert atmosphere,2-8°C | | solubility | H2O: soluble50mg/mL | | form | powder | | color | White to Off-White | | Water Solubility | Soluble in water | | Merck | 14,8206 | | Stability: | Hygroscopic | | InChIKey | RTCDDYYZMGGHOE-CARKYZAMNA-N | | SMILES | OS(O)(=O)=O.NC[C@@H]1O[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O)[C@@H]2O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)[C@@H](N)[C@H](O)[C@H]1O |
| Hazard Codes | T,Xi | | Risk Statements | 61-20/21/22-36/38 | | Safety Statements | 53-22-36/37/39-45-37/39-26 | | WGK Germany | 3 | | RTECS | WK2300000 | | HS Code | 2941.90.1010 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Repr. 1B | | Toxicity | LD50 i.v. in mice: 225 mg/kg (Shomura) |
| | Ribostamycin sulfate Usage And Synthesis |
| Uses | Antibacterial;Ribosomal protein synthesis inhibitor | | Uses | Ribostamycin is a broad-spectrum antimicrobial isolated from Streptomyces ribosifidicus. It is used in pharmacokinetic and nephrotoxicity studies. | | Definition | ChEBI: An aminoglycoside sulfate salt resulting from the reaction of ribostamycin with sulfuric acid. | | Biological Activity | Aminoglycosides, such as ribostamycin, bind to the bacterial 30S and 50S ribosomal subunit, which inhibits the translocation of the peptidyl-tRNA from the A-site to the P-site. This causes misreading of mRNA which makes bacteria unable to make essential proteins. It also inhibits the chaperone activity of protein disulfide isomerase (PDI). | | Synthesis | Preparation of high-purity ribostamycin sulfate: 1. The resolving solution is acidified and diluted. 2. Loaded onto an ion-exchange column, washed with water. 3. Eluted with ammonia, collecting fractions before optical rotation reaches "0". 4. The eluate is concentrated by nanofiltration and then by steam thin-film evaporation. 5. The concentrate is treated with charcoal and spray-dried. |
| | Ribostamycin sulfate Preparation Products And Raw materials |
|