| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(1-Adamantyl)-4-methylphenol Basic information |
| | 2-(1-Adamantyl)-4-methylphenol Chemical Properties |
| Melting point | 128-130 °C(lit.) | | Boiling point | 359.9±21.0 °C(Predicted) | | density | 1.137±0.06 g/cm3 (20 ºC 760 Torr) | | form | Powder | | pka | 10.43±0.43(Predicted) | | color | White | | Water Solubility | Sparingly Soluble in water (7.8E-3 g/L) (25°C). | | InChI | 1S/C17H22O/c1-11-2-3-16(18)15(4-11)17-8-12-5-13(9-17)7-14(6-12)10-17/h2-4,12-14,18H,5-10H2,1H3/t12-,13+,14-,17- | | InChIKey | XHLJIHBDAJFXBE-ZZNDEYBLSA-N | | SMILES | Cc1ccc(O)c(c1)C23C[C@H]4C[C@H](C[C@H](C4)C2)C3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2907290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(1-Adamantyl)-4-methylphenol Usage And Synthesis |
| Uses | 2-(1-Adamantyl)-4-methylphenol, is used as a pharmaceutical intermediate. | | Uses | 2-(1-Adamantyl)-4-methylphenol is a suitable starting reagent used in the synthesis of 2-(1-adamantyl)-4-methylthiophenol. It may also be used in the synthesis of 3-(1-adamantyl)-2-hydroxy-5-methylbenzaldehyde by reacting with urotropin. It may be used in the synthesis of adamantyl-substituted chromium(III) complex, a catalyst for enantioselective hetero-Diels-Alder reactions. | | General Description | 2-(1-Adamantyl)-4-methylphenol is a 2-adamantylphenol derivative. It has been synthesized by the adamantylation of p-cresol with 1-adamantanol. The structure has been confirmed by 1H and 13C NMR. |
| | 2-(1-Adamantyl)-4-methylphenol Preparation Products And Raw materials |
|