2,2-Dimethyl-1-phenylbutan-1-one manufacturers
|
| | 2,2-Dimethyl-1-phenylbutan-1-one Basic information |
| Product Name: | 2,2-Dimethyl-1-phenylbutan-1-one | | Synonyms: | 2,2-DIMETHYLBUTYROPHENONE;1-Butanone, 2,2-dimethyl-1-phenyl-;2,2-Dimethyl-1-phenyl-1-butanone;2,2-Dimethyl-1-phenylbutan-1-one | | CAS: | 829-10-7 | | MF: | C12H16O | | MW: | 176.25 | | EINECS: | 212-587-2 | | Product Categories: | | | Mol File: | 829-10-7.mol |  |
| | 2,2-Dimethyl-1-phenylbutan-1-one Chemical Properties |
| Boiling point | 112.5 °C(Press: 10 Torr) | | density | 0.9866 g/cm3(Temp: 00 °C) | | InChI | InChI=1S/C12H16O/c1-4-12(2,3)11(13)10-8-6-5-7-9-10/h5-9H,4H2,1-3H3 | | InChIKey | MVDVPOYBSSFMQI-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)C(C)(C)CC |
| | 2,2-Dimethyl-1-phenylbutan-1-one Usage And Synthesis |
| | 2,2-Dimethyl-1-phenylbutan-1-one Preparation Products And Raw materials |
|