| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | CHAETOMIN Basic information |
| Product Name: | CHAETOMIN | | Synonyms: | CHAETOMIN;Chetomin,Chaetomin;Chetomin,Chaetomiumspecies;CHETOMIN(RG);NSC 289491;Stereoisomer of 2,3,5a,6,10b,11-hexahydro-3-(hydroxymethyl)-10b-[3-[[4-(hydroxymethyl)-5,7-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]oct-1-yl]methyl]-1H-indol-1-yl]-2-methyl-3,11a-epidithio-11aH-pyrazino[1',2':1,5]pyrrolo[2,3-b]indole-1,4-dione;Monoclonal Anti-HSF4 antibody produced in mouse;DKFZp313O1039 | | CAS: | 1403-36-7 | | MF: | C31H30N6O6S4 | | MW: | 710.87 | | EINECS: | | | Product Categories: | | | Mol File: | 1403-36-7.mol |  |
| | CHAETOMIN Chemical Properties |
| Melting point | 218-220℃ (chloroform ) | | density | 1.78±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble | | form | Off-white to fawn solid. | | pka | 12.69±0.10(Predicted) | | color | Off-white to fawn | | biological source | mouse | | InChIKey | ZRZWBWPDBOVIGQ-UHFFFAOYSA-N | | SMILES | S1SC9(N(C(=O)C1(N(C9=O)C)CO)C)Cc2c3c([n](c2)C54C(N7C8(SSC(N(C8=O)C)(C7=O)CO)C5)Nc6c4cccc6)cccc3 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral | | Toxicity | rat,LD50,oral,75mg/kg (75mg/kg),"CRC Handbook of Antibiotic Compounds," Vols.1- , Berdy, J., Boca Raton, FL, CRC Press, 1980Vol. 4(1), Pg. 174, 1980. |
| | CHAETOMIN Usage And Synthesis |
| Uses | Chetomin is an antibacterial agent and inhibitor of HIF. | | Definition | ChEBI: An organic heteropentacyclic compound of the class of epipolythiodioxopiperazine. Isolated from Chaetomium globosum and Farrowia seminuda, it exhibits immunosuppressive activity. | | Biochem/physiol Actions | Chetomin is a natural metabolite produced by several species of the genus Chaetomium. Chetomin is an epidithiodioxopiperazine known to disrupt the hypoxia-inducible factor (HIF) pathway. Chetomin blocks the interaction of HIF1α and HIF2α with transcriptional co-activators p300 and cAMP response element binding (CREB) binding protein (CBP), thereby attenuating hypoxia-inducible transcription. Disrupting the ability of tumors to adapt to hypoxia leads to decreased tumor growth and can serve as an antitumor stratagy. Chetomin also suppresses the proliferation of LPS-induced mouse spleen lymphocytes. | | in vivo | Chetomin (0~100 mg/kg; p.o.) inhibits lung tumorigenesis in NSCLC mouse models[1].
Chetomin markedly decreases tumor formation in several murine models of NSCLC[1]. | Animal Model: | Mouse | | Dosage: | 0~100 mg/kg | | Administration: | P.o. | | Result: | Inhibited lung tumorigenesis in NSCLC mouse models.
|
| | IC 50 | HSP90 | | storage | +4°C |
| | CHAETOMIN Preparation Products And Raw materials |
|