| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | O-Allyl-N-(9-anthracenylmethyl)cinchonidinium bromide Basic information |
| | O-Allyl-N-(9-anthracenylmethyl)cinchonidinium bromide Chemical Properties |
| Melting point | 170 °C (dec.)(lit.) | | alpha | -340 º (C=0.45 IN CHLOROFORM) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Light yellow to light brown Solid | | Optical Rotation | [α]20/D 345±30°, c = 0.45 in chloroform | | InChIKey | QOWNPAUSLGATNL-JNKXQCINSA-M | | SMILES | [Br-].[H][C@@]12CC[N+](C[C@@H]1C=C)(Cc3c4ccccc4cc5ccccc35)[C@@]([H])(C2)[C@H](OCC=C)c6ccnc7ccccc67 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | O-Allyl-N-(9-anthracenylmethyl)cinchonidinium bromide Usage And Synthesis |
| Uses | O-Allyl-N-(9-anthracenylmethyl)cinchonidinium bromide can catalyze the asymmetric alkylation of tert-butyl glycinate-benzophenone Schiff base with different arylmethyl bromides in a micellar medium. | | General Description | O-Allyl-N-(9-anthracenylmethyl)cinchonidinium bromide is a cinchona-based chiral phase-transfer catalyst (PTC) that can be used in asymmetric synthesis. It can be prepared from N-(9-anthracenylmethyl)cinchonindinium chloride. |
| | O-Allyl-N-(9-anthracenylmethyl)cinchonidinium bromide Preparation Products And Raw materials |
|