- Bicyclo Ketone
-
- $10.00
-
2026-05-28
- CAS:74288-40-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10 ton
- ADC-13
-
- $29.00
-
2026-04-20
- CAS:74288-40-7
- Purity: 98.98%
- Supply Ability: 10g
|
| | p-Nitrobenzyl-6-(1-hydroxyethyl)-1-azabicyclo(3.2.0)heptane-3,7-dione-2-carboxylate Basic information |
| Product Name: | p-Nitrobenzyl-6-(1-hydroxyethyl)-1-azabicyclo(3.2.0)heptane-3,7-dione-2-carboxylate | | Synonyms: | INTERMEDIANTE FOR IMIPENEM;adc 13;6-[(1R)-1-Hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (5R,6S)-(4-nitrophenyl)methyl ester;4-NITROBENZYL (5R,6S)-6-[(1R)-1-HYDROXYETHYL]-3,7-DIOXO-1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLATE;1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLIC ACID, 6-[(1R)-1-HYDROXYETHYL]-3,7-DIOXO-, (4-NITROPHENYL)METHYL ESTER, (5R,6S)-;P-NITROBENZYL-6-(1-HYDROXYETHYL)-1-AZABICYCLO(3.2.0) HEPTANE-3,7-DIONE-2-CARBOXYLATE;6-(1-Hydroxy-ethyl)-3,7-dioxo-1-aza-bicyclo(3.2.0)heptane-2-carboxylic Acid 4-Nitro-benzyl Ester;(5R,6S)-6[(1R)-1-hydroxyethyl]-1-azabicyclo[3.2.0]-heptan-3,7-dione-2-carboxylic acid-p-nitro benzyl ester | | CAS: | 74288-40-7 | | MF: | C16H16N2O7 | | MW: | 348.31 | | EINECS: | 616-072-7 | | Product Categories: | (intermediate of imipenem,panipenem);Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 74288-40-7.mol |  |
| | p-Nitrobenzyl-6-(1-hydroxyethyl)-1-azabicyclo(3.2.0)heptane-3,7-dione-2-carboxylate Chemical Properties |
| Melting point | 108-110°C | | Boiling point | 601.3±55.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 11.26±0.40(Predicted) | | color | White to Pale Beige | | biological source | rabbit | | InChI | InChI=1S/C16H16N2O7/c1-8(19)13-11-6-12(20)14(17(11)15(13)21)16(22)25-7-9-2-4-10(5-3-9)18(23)24/h2-5,8,11,13-14,19H,6-7H2,1H3/t8-,11-,13-,14/m1/s1 | | InChIKey | YBIDYTOJOXKBLO-USLOAXSXSA-N | | SMILES | N12[C@@]([H])([C@@H]([C@H](O)C)C1=O)CC(=O)C2C(OCC1=CC=C([N+]([O-])=O)C=C1)=O | | CAS DataBase Reference | 74288-40-7(CAS DataBase Reference) |
| Storage Class | 10 - Combustible liquids |
| | p-Nitrobenzyl-6-(1-hydroxyethyl)-1-azabicyclo(3.2.0)heptane-3,7-dione-2-carboxylate Usage And Synthesis |
| Chemical Properties | White to Off-White Powder | | Uses | Imipenem intermediate. | | Application | intermediate in orgaic syntheses | | storage | sealed in dry, store in freezer, under -20°C |
| | p-Nitrobenzyl-6-(1-hydroxyethyl)-1-azabicyclo(3.2.0)heptane-3,7-dione-2-carboxylate Preparation Products And Raw materials |
|