| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-(Diethylamino)propyl isothiocyanate manufacturers
|
| | 3-(Diethylamino)propyl isothiocyanate Basic information |
| | 3-(Diethylamino)propyl isothiocyanate Chemical Properties |
| Boiling point | 95 °C | | density | 0.954 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5000(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 10.14±0.25(Predicted) | | Specific Gravity | 0.95 | | Sensitive | Moisture Sensitive | | BRN | 1757446 | | InChI | InChI=1S/C8H16N2S/c1-3-10(4-2)7-5-6-9-8-11/h3-7H2,1-2H3 | | InChIKey | QPBVKSLJBRCKIF-UHFFFAOYSA-N | | SMILES | C(N(CC)CC)CCN=C=S | | CAS DataBase Reference | 2626-52-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | RIDADR | 2927 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 3-(Diethylamino)propyl isothiocyanate Usage And Synthesis |
| Uses | 3-(Diethylamino)propyl isothiocyanate (DEAP) may be used to synthesize GCS-g-DEAP [glycol chitosan (GCS) grafted with DEAP groups]. |
| | 3-(Diethylamino)propyl isothiocyanate Preparation Products And Raw materials |
|