| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
SIMAGCHEM CORP |
| Tel: |
+86-5922680277 +86-13806087780 |
| Email: |
sale@simagchem.com |
4,4'-Methylene bis(dibutyldithiocarbamate) manufacturers
- Runlube 8723
-
-
2026-09-11
- CAS:10254-57-6
- Min. Order: 1KG
- Purity: 0.98
- Supply Ability: 20000 KG
|
| | 4,4'-Methylene bis(dibutyldithiocarbamate) Basic information |
| Product Name: | 4,4'-Methylene bis(dibutyldithiocarbamate) | | Synonyms: | Methylene bis(dibutylthiocarbamate);bis(di-n-Butylthiocarbamoylthio)methane;Carbamodithioicacid,dibutyl-,methyleneester;dibutylcarbamodithioicacidmethyleneester;dibutyl-carbamodithioicacimethyleneester;VANLUBE-7723;4,4-Methylen-bis(dibutyldithiocarbamat);Bis(dibutyldithiocarbamic acid)methylene ester | | CAS: | 10254-57-6 | | MF: | C19H38N2S4 | | MW: | 422.78 | | EINECS: | 233-593-1 | | Product Categories: | | | Mol File: | 10254-57-6.mol |  |
| | 4,4'-Methylene bis(dibutyldithiocarbamate) Chemical Properties |
| Boiling point | 486.7±55.0 °C(Predicted) | | density | 1.071±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | pka | 1.09±0.50(Predicted) | | Water Solubility | 243μg/L at 20℃ | | InChI | InChI=1S/C19H38N2S4/c1-5-9-13-20(14-10-6-2)18(22)24-17-25-19(23)21(15-11-7-3)16-12-8-4/h5-17H2,1-4H3 | | InChIKey | LMODBLQHQHXPEI-UHFFFAOYSA-N | | SMILES | N(CCCC)(CCCC)C(=S)SCSC(=S)N(CCCC)CCCC | | LogP | 8.42 at 35℃ | | EPA Substance Registry System | Methylene dibutyldithiocarbamate (10254-57-6) |
| | 4,4'-Methylene bis(dibutyldithiocarbamate) Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | 4,4'-Methylene bis(dibutyldithiocarbamate) Preparation Products And Raw materials |
|