| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Boc-Cys(Npys)-OH manufacturers
- BOC-CYS(NPYS)-OH
-
-
2025-04-04
- CAS:76880-29-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
|
| | Boc-Cys(Npys)-OH Basic information |
| Product Name: | Boc-Cys(Npys)-OH | | Synonyms: | Boc-Cys(Npys)-OH >=99.0% (TLC);nα-boc-s-(3-nitro-2-pyridylthio)-l-cysteine;t-butyloxycarbonyl-(S-(3-nitro-2-pyridinesulfenyl))cysteine;N-tert-Butoxycarbonyl-[S-(3-nitro-2-pyridinesulfenyl)]-L-cysteine;(Tert-Butoxy)Carbonyl Cys(Npys)-OH;Boc-L-Cys(Npys)-OH;Boc-S-3-nitro-2-pyridinesulfenyl-L-cysteine99%;N-ALPHA-T-BUTOXYCARBONYL-S-(3-NITRO-2-PYRIDINESULFENYL)-L-CYSTEINE | | CAS: | 76880-29-0 | | MF: | C13H17N3O6S2 | | MW: | 375.42 | | EINECS: | | | Product Categories: | | | Mol File: | 76880-29-0.mol |  |
| | Boc-Cys(Npys)-OH Chemical Properties |
| Melting point | ~160 °C (dec.) | | Boiling point | 553.9±50.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 3.34±0.10(Predicted) | | form | Powder | | color | Pale yellow | | Optical Rotation | [α]20/D 94±5°, c = 1% in methanol | | Sensitive | Moisture Sensitive | | BRN | 3569570 | | Major Application | peptide synthesis | | InChI | 1S/C13H17N3O6S2/c1-13(2,3)22-12(19)15-8(11(17)18)7-23-24-10-9(16(20)21)5-4-6-14-10/h4-6,8H,7H2,1-3H3,(H,15,19)(H,17,18)/t8-/m0/s1 | | InChIKey | OVTLOLNDKQUMRH-QMMMGPOBSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CSSc1ncccc1[N+]([O-])=O)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2933399990 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-Cys(Npys)-OH Usage And Synthesis |
| Uses | N-Boc-S-(3-nitro-2-pyridylthio)-L-cysteine is used as medical intermediates. |
| | Boc-Cys(Npys)-OH Preparation Products And Raw materials |
|