| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Phenylacetic acid trans-2-hexen-1-yl ester Basic information |
| Product Name: | Phenylacetic acid trans-2-hexen-1-yl ester | | Synonyms: | TRANS-2-HEXENYL PHENYLACETATE;TRANS-2-HEXEN-1-YL PHENYLACETATE;2-hexenylester,(e)-benzeneaceticaci;Phenylaceticacidhexenylester;(E)-hex-2-enyl phenylacetate;BENZENEACETICACID,2-HEXENYLESTER,(E)-;Benzeneacetic acid, (2E)-2-hexenyl ester;(E)-Hex-2-enylphenylacetat | | CAS: | 68133-78-8 | | MF: | C14H18O2 | | MW: | 218.29 | | EINECS: | 268-705-8 | | Product Categories: | | | Mol File: | 68133-78-8.mol |  |
| | Phenylacetic acid trans-2-hexen-1-yl ester Chemical Properties |
| density | 0.99 | | refractive index | 1.4970 to 1.5010 | | Odor | at 100.00 %. green mossy rum honey | | Odor Type | green | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C14H18O2/c1-2-3-4-8-11-16-14(15)12-13-9-6-5-7-10-13/h4-10H,2-3,11-12H2,1H3/b8-4+ | | InChIKey | BYGAPGDXGHDYGP-XBXARRHUSA-N | | SMILES | C1(CC(OC/C=C/CCC)=O)=CC=CC=C1 | | LogP | 4.391 (est) | | EPA Substance Registry System | Benzeneacetic acid, (2E)-2-hexenyl ester (68133-78-8) |
| TSCA | TSCA listed | | HS Code | 2916.39.7700 |
| | Phenylacetic acid trans-2-hexen-1-yl ester Usage And Synthesis |
| Chemical Properties | Colorless, shghtly viscous liquid. lnsolubie in water, soluble in alcohoi and oils. | | Preparation |
Trans-2-Hexenyl phenylacetate is produced from trans-2-Hexenol and Phenylacetic acid under azeotropic esterification conditions.
|
| | Phenylacetic acid trans-2-hexen-1-yl ester Preparation Products And Raw materials |
|