| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-(Trifluoromethyl)benzylzinc chloride Basic information |
| Product Name: | 3-(Trifluoromethyl)benzylzinc chloride | | Synonyms: | 3-(TRIFLUOROMETHYL)BENZYLZINC CHLORIDE,0.5M SOLUTION IN TETRAHYDROFURAN;3-(trifluoromethyl)benzylzinc chloride solution;3-(Trifluoromethyl)benzylzinc chloride solution 0.5 in THF;3-(Trifluoromethyl)benzylzinc chloride solution 0.5M in THF;3-Trifluoromethylbenzylzinc chloride 0.5 M in Tetrahydrofuran;chlorozinc(1+),1-methanidyl-3-(trifluoromethyl)benzene;3-(Trifluoromethyl)benzylzinc chloride, 0.5 M in THF - [T94940];3-(Trifluoromethyl)benzylzinc chloride | | CAS: | 480438-42-4 | | MF: | C8H6ClF3Zn | | MW: | 259.97 | | EINECS: | | | Product Categories: | Alkyl;Organozinc Halides;Reike and Organozinc Reagents | | Mol File: | 480438-42-4.mol |  |
| | 3-(Trifluoromethyl)benzylzinc chloride Chemical Properties |
| Boiling point | 65 °C | | density | 0.986 g/mL at 25 °C | | Fp | 1 °F | | storage temp. | 2-8°C | | InChI | 1S/C8H6F3.ClH.Zn/c1-6-3-2-4-7(5-6)8(9,10)11;;/h2-5H,1H2;1H;/q;;+1/p-1 | | InChIKey | WNPDTQVRJMVKON-UHFFFAOYSA-M | | SMILES | FC(F)(F)c1cccc(C[Zn]Cl)c1 |
| Hazard Codes | F,Xi,Xn | | Risk Statements | 11-19-36/37-40 | | Safety Statements | 16-29-33-36/37-26 | | RIDADR | UN 2056 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | 3-(Trifluoromethyl)benzylzinc chloride Usage And Synthesis |
| | 3-(Trifluoromethyl)benzylzinc chloride Preparation Products And Raw materials |
|