| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:1-(p-Toluenesulfonyl)azetidine, 97%
CAS:7730-45-2
Package:250Mg Remarks:H55601
|
|
| | 1-(P-TOLYLSULFONYL)AZETIDINE Basic information |
| Product Name: | 1-(P-TOLYLSULFONYL)AZETIDINE | | Synonyms: | 1-(4-Methylphenyl)sulfonylazetidine;1-(P-TOLYLSULFONYL)AZETIDINE;1-(p-Toluenesulfonyl)azetidine;1-(toluene-4-sulfonyl)azetidine;1-tosylazetidine;Azetidine, 1-[(4-methylphenyl)sulfonyl]-;N-(p-Tolylsulfonyl)azetidine;1-(p-Toluenesulfonyl)azetidine | | CAS: | 7730-45-2 | | MF: | C10H13NO2S | | MW: | 211.28 | | EINECS: | | | Product Categories: | | | Mol File: | 7730-45-2.mol |  |
| | 1-(P-TOLYLSULFONYL)AZETIDINE Chemical Properties |
| Melting point | 119-122 °C(lit.) | | form | solid | | BRN | 177046 | | InChI | 1S/C10H13NO2S/c1-9-3-5-10(6-4-9)14(12,13)11-7-2-8-11/h3-6H,2,7-8H2,1H3 | | InChIKey | VKCBXONEZGIOSP-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)N2CCC2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | 1-(P-TOLYLSULFONYL)AZETIDINE Usage And Synthesis |
| Uses | 1-(p-Toluenesulfonyl)azetidine is a heterocyclic building block. Ag(I)-catalyzed ring-opening of 1-(p-toluenesulfonyl)azetidine (N-tosylazetidine) with alcohols, amines, thiols and related tethered 1,2-ethane dinucleophiles has been reported. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 26, p. 138, 1961 DOI: 10.1021/jo01060a033 | | General Description | 1-(p-Toluenesulfonyl)azetidine is a heterocyclic building block. Ag(I)-catalyzed ring-opening of 1-(p-toluenesulfonyl)azetidine (N-tosylazetidine) with alcohols, amines, thiols and related tethered 1,2-ethane dinucleophiles has been reported. |
| | 1-(P-TOLYLSULFONYL)AZETIDINE Preparation Products And Raw materials |
|