|
|
| | (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester Basic information |
| Product Name: | (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester | | Synonyms: | (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester;Saxagliptin Intermediate 1;ethyl N- Boc- 4,5- dehydroprolinate;1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate;(5S)-4,5-dihydro-1H-pyrrole-1,5-dicarboxylic?acid?1-(1,1-dimethylethyl)-5-ethyl?ester;1-tert-butyl 2-ethyl (2S)-2,3-dihydro-1H-pyrrole-1,2-dicarboxylate;1-(tert-butyl) 2-ethyl (S)-2,3-dihydro-1H-pyrrole-1,2-dicarboxylate;1H-Pyrrole-1,2-dicarboxylic acid, 2,3-dihydro-, 1-(1,1-dimethylethyl) 2-ethyl ester, (2S)- | | CAS: | 178172-26-4 | | MF: | C12H19NO4 | | MW: | 241.28 | | EINECS: | | | Product Categories: | | | Mol File: | 178172-26-4.mol |  |
| | (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester Chemical Properties |
| Boiling point | 315.6±42.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -2.52±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H19NO4/c1-5-16-10(14)9-7-6-8-13(9)11(15)17-12(2,3)4/h6,8-9H,5,7H2,1-4H3/t9-/m0/s1 | | InChIKey | AZVLZXHTXUIWRZ-VIFPVBQESA-N | | SMILES | N1(C(OC(C)(C)C)=O)C=CC[C@H]1C(OCC)=O |
| | (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester Usage And Synthesis |
| Chemical Properties | pale yelllow oily liquid | | Uses | (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic Acid is used to prepare captopril analogs as inhibitors of angiotensin converting enzyme. It is also used to prepare stereoisomers of DPP-IV inhibitor saxagliptin. |
| | (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester Preparation Products And Raw materials |
| Raw materials | Ethyl L-pyroglutamate-->1,2-Pyrrolidinedicarboxylic acid, 5-Methoxy-, 1-(1,1-diMethylethyl) 2-ethyl ester, (2S)--->1,2-Pyrrolidinedicarboxylic acid, 5-hydroxy-, 1-(1,1-diMethylethyl) 2-ethyl ester, (2S)--->Di-tert-butyl dicarbonate-->L-Pyroglutamic acid | | Preparation Products | (1S,3S,5S)-2-(tert-Butoxycarbonyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid-->(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide methanesulfonate |
|