| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:1-Methyl-2-(tributylstannyl)-1H-pyrrole CAS:118486-97-8 Purity:97% Package:1g
|
1-METHYL-2-(TRIBUTYLSTANNYL)-1H-PYRROLE manufacturers
|
| | 1-METHYL-2-(TRIBUTYLSTANNYL)-1H-PYRROLE Basic information |
| | 1-METHYL-2-(TRIBUTYLSTANNYL)-1H-PYRROLE Chemical Properties |
| Boiling point | 376.3±34.0 °C(Predicted) | | density | 1.1223 g/mL at 25 °C | | refractive index | n20/D 1.5107 | | Fp | 98 °C | | storage temp. | -20°C | | solubility | Not miscible or difficult to mix. | | pka | -2.77±0.70(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C5H6N.3C4H9.Sn/c1-6-4-2-3-5-6;3*1-3-4-2;/h2-4H,1H3;3*1,3-4H2,2H3; | | InChIKey | DINAKCGOEKXDTP-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1cccn1C | | CAS DataBase Reference | 118486-97-8 |
| Hazard Codes | T,Xi,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 26-28-36/37-45-60-61 | | RIDADR | UN 2788 6.1/PG 2 | | WGK Germany | 3 | | HazardClass | 6.1 | | HazardClass | IRRITANT, AIR SENSITIVE, MOISTURE SENSITIVE, KEEP COLD | | HS Code | 29321900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 1-METHYL-2-(TRIBUTYLSTANNYL)-1H-PYRROLE Usage And Synthesis |
| Uses | It is employed as intermediate for pharmaceutical. | | Uses | 1-Methyl-2-(tributylstannyl)pyrrole can be used as a reactant to prepare:
- Bithienylpyrrole derivatives through a Stille coupling reaction with bithienyl bromides in the presence of Pd catalyst.
- Di(bisthienyl)-o-carborane (DBTC) by reacting with 5,5′-dibromo-o-carboranyl-bisthiophenes using Pd catalyst. DBTC is electropolymerized to produce conducting polymers.
- Poly(Py-BTz-Py) (2-butyl-4,7-bis(1-methyl-1H-pyrrol-2-yl)-2H-benzo[d][1,2,3]triazole) via Stille coupling reaction. Poly(Py-BTz-Py) can be used as an organic photocatalyst for the formation C-C bond under visible light irradiation.
|
| | 1-METHYL-2-(TRIBUTYLSTANNYL)-1H-PYRROLE Preparation Products And Raw materials |
|