|
|
| | Isopropenyltributylstannane Basic information |
| Product Name: | Isopropenyltributylstannane | | Synonyms: | Isopropenyltributylstannane;Tributyl(1-methylethenyl)stannane;Tributyl(isopropenyl)stannane;Tributylisopropenyltin;2-(Tributylstannyl)propene;tributyl(prop-1-en-2-yl)stannane;ISOPROPENYLTRI-n-BUTYLTIN;Tri-n-butylisopropenyltin | | CAS: | 100073-15-2 | | MF: | C15H32Sn | | MW: | 331.12 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | 100073-15-2.mol |  |
| | Isopropenyltributylstannane Chemical Properties |
| Melting point | 70-70°C / 0.1 | | Boiling point | 312.0±25.0 °C(Predicted) | | storage temp. | 2-8°C | | form | solid | | Specific Gravity | 1.01 | | Appearance | Colorless Liquid | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | InChI | 1S/3C4H9.C3H5.Sn/c3*1-3-4-2;1-3-2;/h3*1,3-4H2,2H3;1H2,2H3; | | InChIKey | PUMSLVXNEXVCIC-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)C(C)=C |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | Isopropenyltributylstannane Usage And Synthesis |
| | Isopropenyltributylstannane Preparation Products And Raw materials |
|