|
|
| | 1-(4-Fluorophenyl)-2-phenyl-ethanone Basic information |
| Product Name: | 1-(4-Fluorophenyl)-2-phenyl-ethanone | | Synonyms: | BENZYL 4-FLUOROPHENYL KETONE;1-(4-Fluorophenyl)-2-phenylethanone 99%;1-(4-Fluorophenyl)-2-phenylethanone99%;Atorvastatin Impurity 78;Benzyl 4-Fluorophenyl Ketone >Ethanone, 1-(4-fluorophenyl)-2-phenyl-;17-(4-fluorophenyl)-2-phenyl- ethanone;Ethanone,17-(4-fluorophenyl)-2-phenyl- | | CAS: | 347-84-2 | | MF: | C14H11FO | | MW: | 214.23 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 347-84-2.mol |  |
| | 1-(4-Fluorophenyl)-2-phenyl-ethanone Chemical Properties |
| Melting point | 83-84 | | Boiling point | 332.9±17.0 °C(Predicted) | | density | 1.152±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C14H11FO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 | | InChIKey | YFYKGCQUWKAFLW-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(F)C=C1)CC1=CC=CC=C1 | | CAS DataBase Reference | 347-84-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | HazardClass | IRRITANT | | HS Code | 2914390090 | | Storage Class | 11 - Combustible Solids |
| | 1-(4-Fluorophenyl)-2-phenyl-ethanone Usage And Synthesis |
| Uses | 1-(4-Fluorophenyl)-2-phenyl-ethanone is used in the preparation and evaluation of 2,3-diarylpyrazines and quinoxalines as selective COX-2 inhibitors. |
| | 1-(4-Fluorophenyl)-2-phenyl-ethanone Preparation Products And Raw materials |
|