|
|
| | (S)-Tropic acid Basic information |
| Product Name: | (S)-Tropic acid | | Synonyms: | (S)-Tropic acid;[S,(-)]-3-Hydroxy-2-phenylpropionic acid;L-Tropic acid;Atropine Impurity 13;(S）-3-hydroxy-2-phenylpropanoic acid;Benzeneacetic acid, α-(hydroxymethyl)-, (αS)-;Tiotropium bromide Impurity 33;(-)-Tropic acid | | CAS: | 16202-15-6 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | | | Product Categories: | | | Mol File: | 16202-15-6.mol |  |
| | (S)-Tropic acid Chemical Properties |
| Melting point | 126-127 °C | | Boiling point | 322.5±30.0 °C(Predicted) | | density | 1.262±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.85±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/s3 | | InChIKey | JACRWUWPXAESPB-SBYBRXNCNA-N | | SMILES | C(O)(=O)[C@@H](C1=CC=CC=C1)CO |&1:3,r| |
| | (S)-Tropic acid Usage And Synthesis |
| Uses | (S)-Tropic Acid is used as a reagent in the synthesis of Scopolamine (S200005) and its salts. | | Definition | ChEBI: (S)-tropic acid is a tropic acid. It is functionally related to a (R)-hydratropic acid. It is an enantiomer of a (R)-tropic acid. |
| | (S)-Tropic acid Preparation Products And Raw materials |
|