- Pseudotropine
-
- $29.00
-
2026-04-22
- CAS:135-97-7
- Purity: 98.00%
- Supply Ability: 10g
- Pseudotropine
-
- $29.00
-
2026-04-22
- CAS:135-97-7
- Purity: 98.00%
- Supply Ability: 10g
|
| | Pseudotropine Basic information |
| Product Name: | Pseudotropine | | Synonyms: | exo-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;PSEUDOTROPANOL;PSEUDOTROPINE;3-hydroxytropane;8-Methyl-8-azabicyclo[3.2.1]-3-octanol;1-alpha-h,5-alpha-h-tropan-3-beta-ol;3-beta-tropanol;exo-8-azabicyclo(3.2.1)octan-3-o | | CAS: | 135-97-7 | | MF: | C8H15NO | | MW: | 141.21 | | EINECS: | 205-226-5 | | Product Categories: | | | Mol File: | 135-97-7.mol |  |
| | Pseudotropine Chemical Properties |
| Melting point | 109° | | Boiling point | bp 241° | | density | 0.9938 (rough estimate) | | refractive index | 1.4811 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.80(at 15℃) | | color | Off-White to Pale Beige | | InChI | InChI=1/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8- | | InChIKey | CYHOMWAPJJPNMW-RNLVFQAGNA-N | | SMILES | [C@@]12([H])CC[C@@]([H])(C[C@H](O)C1)N2C |&1:0,4,7,r| | | CAS DataBase Reference | 135-97-7(CAS DataBase Reference) | | NIST Chemistry Reference | 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, exo-(135-97-7) |
| | Pseudotropine Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | ψ-Tropine is used in the preparation of novel nicotinic receptor agonists. | | Definition | ChEBI: Tropine is a derivative of tropane having a hydroxy group at the 3-position. It has a role as a mouse metabolite. It is a conjugate base of a tropinium. |
| | Pseudotropine Preparation Products And Raw materials |
|