|
|
| | (Z)-3-[4-(Dimethylamino)benzylidenyl]indolin-2-one Basic information |
| Product Name: | (Z)-3-[4-(Dimethylamino)benzylidenyl]indolin-2-one | | Synonyms: | 4-(1,3-Dimethyl-2,3-dihydro-1H-benzoimidazol-2-yl)phenyl)dimethylamine;4-(2,3-Dihydro-1,3-dimethyl-1H-benzimidazol-2-yl)-N,N-dimethylbenzenamine;4-(1,3-dimethyl-2H-1,3-benzodiazol-2-yl)-N,N-dimethylaniline;1,3-Dimethyl-2-phenyl-2,3-dihydro-1H-benzoimidazole;4-(2,3-Dihydro-1,3-dimethyl-1H-benzimidazol-2-yl)-N,N-dimethylbenzenamine 98% (HPLC);4-(2,3-Dihydro-1,3-dimethyl-1H-benzimidazol-2-yl);Benzenamine, 4-(2,3-dihydro-1,3-dimethyl-1H-benzimidazol-2-yl)-N,N-dimethyl-;4-(1,3-Dimethyl-2,3-dihydro-1H-benzo[d]imidazol-2-yl)-N,N-dimethylaniline | | CAS: | 302818-73-1 | | MF: | C17H21N3 | | MW: | 267.37 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![(Z)-3-[4-(Dimethylamino)benzylidenyl]indolin-2-one Structure](StructureFile/ChemBookStructure2/GIF/CB4229166.gif) |
| | (Z)-3-[4-(Dimethylamino)benzylidenyl]indolin-2-one Chemical Properties |
| Melting point | 105-110°C | | Boiling point | 419.1±45.0 °C(Predicted) | | density | 1.101±0.06 g/cm3(Predicted) | | pka | 6.18±0.40(Predicted) | | form | solid | | InChI | InChI=1S/C17H21N3/c1-18(2)14-11-9-13(10-12-14)17-19(3)15-7-5-6-8-16(15)20(17)4/h5-12,17H,1-4H3 | | InChIKey | AKIIMLCQTGCWQQ-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=C(C2N(C)C3=CC=CC=C3N2C)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (Z)-3-[4-(Dimethylamino)benzylidenyl]indolin-2-one Usage And Synthesis |
| Uses | Air stable n-type dopant for n-channel Organic Thin Film Transistors (OTFTs) and solar cells (OPVs). | | General Description | 4-(2,3-Dihydro-1,3-dimethyl-1H-benzimidazol-2-yl)-N,N-dimethylbenzenamine is a semiconducting organic molecule with a π-conjugated polycyclic system. It is a strong electron donor molecule that can be used for n-type doping. It shows conductivity of ~2 × 103S/cm as a dopant. It also acts as a reagent for the reductive transformation of organic compounds. |
| | (Z)-3-[4-(Dimethylamino)benzylidenyl]indolin-2-one Preparation Products And Raw materials |
|